About 2-methyloctane;titanium(4+);trihydroxide
2-methyloctane;titanium(4+);trihydroxide (PubChem CID 174186181) has the molecular formula C9H22O3Ti
and a molecular weight of 226.14 g/mol. Its IUPAC name is 2-methyloctane;titanium(4+);trihydroxide.
Molecular Properties
| Compound Name | 2-methyloctane;titanium(4+);trihydroxide |
| PubChem CID | 174186181 |
| Molecular Formula | C9H22O3Ti |
| Molecular Weight | 226.14 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 2-methyloctane;titanium(4+);trihydroxide |
| SMILES | [CH2-]CCCCCC(C)C.[OH-].[OH-].[OH-].[Ti+4] |
| InChI | InChI=1S/C9H19.3H2O.Ti/c1-4-5-6-7-8-9(2)3;;;;/h9H,1,4-8H2,2-3H3;3*1H2;/q-1;;;;+4/p-3 |
| InChIKey | AABMZRUBHQLLQE-UHFFFAOYSA-K |
| XLogP | 2.89 |
| TPSA | 90.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.14 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-methyloctane;titanium(4+);trihydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyloctane;titanium(4+);trihydroxide?
The IUPAC name of 2-methyloctane;titanium(4+);trihydroxide (CID 174186181) is 2-methyloctane;titanium(4+);trihydroxide.
What is the SMILES notation for 2-methyloctane;titanium(4+);trihydroxide?
The canonical SMILES for 2-methyloctane;titanium(4+);trihydroxide is [CH2-]CCCCCC(C)C.[OH-].[OH-].[OH-].[Ti+4].
What is the InChIKey of 2-methyloctane;titanium(4+);trihydroxide?
The InChIKey is AABMZRUBHQLLQE-UHFFFAOYSA-K. The full InChI is InChI=1S/C9H19.3H2O.Ti/c1-4-5-6-7-8-9(2)3;;;;/h9H,1,4-8H2,2-3H3;3*1H2;/q-1;;;;+4/p-3.
What are the key properties of 2-methyloctane;titanium(4+);trihydroxide?
2-methyloctane;titanium(4+);trihydroxide has a molecular weight of 226.14 g/mol, XLogP of 2.89, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyloctane;titanium(4+);trihydroxide is sourced from PubChem (CID 174186181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).