About magnesium;butane;2-methylheptane
magnesium;butane;2-methylheptane (PubChem CID 154098905) has the molecular formula C12H26Mg
and a molecular weight of 194.64 g/mol. Its IUPAC name is magnesium;butane;2-methylheptane.
Molecular Properties
| Compound Name | magnesium;butane;2-methylheptane |
| PubChem CID | 154098905 |
| Molecular Formula | C12H26Mg |
| Molecular Weight | 194.64 g/mol |
| Exact Mass | 194.19 |
| IUPAC Name | magnesium;butane;2-methylheptane |
| SMILES | C[CH-]CC.[CH2-]CCCCC(C)C.[Mg+2] |
| InChI | InChI=1S/C8H17.C4H9.Mg/c1-4-5-6-7-8(2)3;1-3-4-2;/h8H,1,4-7H2,2-3H3;3H,4H2,1-2H3;/q2*-1;+2 |
| InChIKey | QSLYEPFNIROUPV-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.64 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze magnesium;butane;2-methylheptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;butane;2-methylheptane?
The IUPAC name of magnesium;butane;2-methylheptane (CID 154098905) is magnesium;butane;2-methylheptane.
What is the SMILES notation for magnesium;butane;2-methylheptane?
The canonical SMILES for magnesium;butane;2-methylheptane is C[CH-]CC.[CH2-]CCCCC(C)C.[Mg+2].
What is the InChIKey of magnesium;butane;2-methylheptane?
The InChIKey is QSLYEPFNIROUPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17.C4H9.Mg/c1-4-5-6-7-8(2)3;1-3-4-2;/h8H,1,4-7H2,2-3H3;3H,4H2,1-2H3;/q2*-1;+2.
What are the key properties of magnesium;butane;2-methylheptane?
magnesium;butane;2-methylheptane has a molecular weight of 194.64 g/mol, XLogP of 4.28, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;butane;2-methylheptane is sourced from PubChem (CID 154098905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).