About 2-methylnonane;titanium;hydrate
2-methylnonane;titanium;hydrate (PubChem CID 174186153) has the molecular formula C10H23OTi-
and a molecular weight of 207.16 g/mol. Its IUPAC name is 2-methylnonane;titanium;hydrate.
Molecular Properties
| Compound Name | 2-methylnonane;titanium;hydrate |
| PubChem CID | 174186153 |
| Molecular Formula | C10H23OTi- |
| Molecular Weight | 207.16 g/mol |
| Exact Mass | 207.12 |
| IUPAC Name | 2-methylnonane;titanium;hydrate |
| SMILES | O.[CH2-]CCCCCCC(C)C.[Ti] |
| InChI | InChI=1S/C10H21.H2O.Ti/c1-4-5-6-7-8-9-10(2)3;;/h10H,1,4-9H2,2-3H3;1H2;/q-1;; |
| InChIKey | UOZVHDVYWYZXKT-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 31.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.16 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-methylnonane;titanium;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylnonane;titanium;hydrate?
The IUPAC name of 2-methylnonane;titanium;hydrate (CID 174186153) is 2-methylnonane;titanium;hydrate.
What is the SMILES notation for 2-methylnonane;titanium;hydrate?
The canonical SMILES for 2-methylnonane;titanium;hydrate is O.[CH2-]CCCCCCC(C)C.[Ti].
What is the InChIKey of 2-methylnonane;titanium;hydrate?
The InChIKey is UOZVHDVYWYZXKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21.H2O.Ti/c1-4-5-6-7-8-9-10(2)3;;/h10H,1,4-9H2,2-3H3;1H2;/q-1;;.
What are the key properties of 2-methylnonane;titanium;hydrate?
2-methylnonane;titanium;hydrate has a molecular weight of 207.16 g/mol, XLogP of 2.99, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylnonane;titanium;hydrate is sourced from PubChem (CID 174186153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).