C16H36 — CID 172617392
ethane;2,3,5,9-tetramethyldecane (PubChem CID 172617392) has the molecular formula C16H36 and a molecular weight of 228.46 g/mol. Its IUPAC name is ethane;2,3,5,9-tetramethyldecane.
| Compound Name | ethane;2,3,5,9-tetramethyldecane |
|---|---|
| PubChem CID | 172617392 |
| Molecular Formula | C16H36 |
| Molecular Weight | 228.46 g/mol |
| Exact Mass | 228.28 |
| IUPAC Name | ethane;2,3,5,9-tetramethyldecane |
| SMILES | CC.CC(C)CCCC(C)CC(C)C(C)C |
| InChI | InChI=1S/C14H30.C2H6/c1-11(2)8-7-9-13(5)10-14(6)12(3)4;1-2/h11-14H,7-10H2,1-6H3;1-2H3 |
| InChIKey | SSRZGLCLESOPIK-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.46 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |