C13H28 — CID 153439349
(3S,7R)-2,3,7,8-tetramethylnonane (PubChem CID 153439349) has the molecular formula C13H28 and a molecular weight of 184.37 g/mol. Its IUPAC name is (3S,7R)-2,3,7,8-tetramethylnonane.
| Compound Name | (3S,7R)-2,3,7,8-tetramethylnonane |
|---|---|
| PubChem CID | 153439349 |
| Molecular Formula | C13H28 |
| Molecular Weight | 184.37 g/mol |
| Exact Mass | 184.22 |
| IUPAC Name | (3S,7R)-2,3,7,8-tetramethylnonane |
| SMILES | CC(C)[C@H](C)CCC[C@H](C)C(C)C |
| InChI | InChI=1S/C13H28/c1-10(2)12(5)8-7-9-13(6)11(3)4/h10-13H,7-9H2,1-6H3/t12-,13+ |
| InChIKey | QNIPWTWBIDELLN-BETUJISGSA-N |
| XLogP | 4.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.37 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |