C8H19N — CID 55283993
4,5-dimethylhexan-1-amine (PubChem CID 55283993) has the molecular formula C8H19N and a molecular weight of 129.25 g/mol. Its IUPAC name is 4,5-dimethylhexan-1-amine.
| Compound Name | 4,5-dimethylhexan-1-amine |
|---|---|
| PubChem CID | 55283993 |
| Molecular Formula | C8H19N |
| Molecular Weight | 129.25 g/mol |
| Exact Mass | 129.15 |
| IUPAC Name | 4,5-dimethylhexan-1-amine |
| SMILES | CC(C)C(C)CCCN |
| InChI | InChI=1S/C8H19N/c1-7(2)8(3)5-4-6-9/h7-8H,4-6,9H2,1-3H3 |
| InChIKey | HTQJGGGPLKSZKR-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.25 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |