C12H30N4 — CID 20755632
4-N-(3-aminopropyl)-5-methyloctane-1,4,8-triamine (PubChem CID 20755632) has the molecular formula C12H30N4 and a molecular weight of 230.40 g/mol. Its IUPAC name is 4-N-(3-aminopropyl)-5-methyloctane-1,4,8-triamine.
| Compound Name | 4-N-(3-aminopropyl)-5-methyloctane-1,4,8-triamine |
|---|---|
| PubChem CID | 20755632 |
| Molecular Formula | C12H30N4 |
| Molecular Weight | 230.40 g/mol |
| Exact Mass | 230.25 |
| IUPAC Name | 4-N-(3-aminopropyl)-5-methyloctane-1,4,8-triamine |
| SMILES | CC(CCCN)C(CCCN)NCCCN |
| InChI | InChI=1S/C12H30N4/c1-11(5-2-7-13)12(6-3-8-14)16-10-4-9-15/h11-12,16H,2-10,13-15H2,1H3 |
| InChIKey | HFHLJVSYYMMCDJ-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 90.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.40 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|