C6H17N3 — CID 21119792
N'-(1-aminoethyl)butane-1,4-diamine (PubChem CID 21119792) has the molecular formula C6H17N3 and a molecular weight of 131.22 g/mol. Its IUPAC name is N'-(1-aminoethyl)butane-1,4-diamine.
| Compound Name | N'-(1-aminoethyl)butane-1,4-diamine |
|---|---|
| PubChem CID | 21119792 |
| Molecular Formula | C6H17N3 |
| Molecular Weight | 131.22 g/mol |
| Exact Mass | 131.14 |
| IUPAC Name | N'-(1-aminoethyl)butane-1,4-diamine |
| SMILES | CC(N)NCCCCN |
| InChI | InChI=1S/C6H17N3/c1-6(8)9-5-3-2-4-7/h6,9H,2-5,7-8H2,1H3 |
| InChIKey | SDJSJRLDDPCRFH-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.22 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|