C12H30N4 — CID 123601298
1-N'-(6-aminohexyl)hexane-1,1,6-triamine (PubChem CID 123601298) has the molecular formula C12H30N4 and a molecular weight of 230.40 g/mol. Its IUPAC name is 1-N'-(6-aminohexyl)hexane-1,1,6-triamine.
| Compound Name | 1-N'-(6-aminohexyl)hexane-1,1,6-triamine |
|---|---|
| PubChem CID | 123601298 |
| Molecular Formula | C12H30N4 |
| Molecular Weight | 230.40 g/mol |
| Exact Mass | 230.25 |
| IUPAC Name | 1-N'-(6-aminohexyl)hexane-1,1,6-triamine |
| SMILES | NCCCCCCNC(N)CCCCCN |
| InChI | InChI=1S/C12H30N4/c13-9-5-1-2-7-11-16-12(15)8-4-3-6-10-14/h12,16H,1-11,13-15H2 |
| InChIKey | SIUBRHUEEAOVQP-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 90.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.40 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|