C5H15ClN2 — CID 140981166
1-N'-propylethane-1,1-diamine;hydrochloride (PubChem CID 140981166) has the molecular formula C5H15ClN2 and a molecular weight of 138.64 g/mol. Its IUPAC name is 1-N'-propylethane-1,1-diamine;hydrochloride.
| Compound Name | 1-N'-propylethane-1,1-diamine;hydrochloride |
|---|---|
| PubChem CID | 140981166 |
| Molecular Formula | C5H15ClN2 |
| Molecular Weight | 138.64 g/mol |
| Exact Mass | 138.09 |
| IUPAC Name | 1-N'-propylethane-1,1-diamine;hydrochloride |
| SMILES | CCCNC(C)N.Cl |
| InChI | InChI=1S/C5H14N2.ClH/c1-3-4-7-5(2)6;/h5,7H,3-4,6H2,1-2H3;1H |
| InChIKey | JVUWJKRFXVXQCN-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.64 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|