C9H22N2O — CID 59834050
1-[2-(propylamino)propoxy]propan-2-amine (PubChem CID 59834050) has the molecular formula C9H22N2O and a molecular weight of 174.29 g/mol. Its IUPAC name is 1-[2-(propylamino)propoxy]propan-2-amine.
| Compound Name | 1-[2-(propylamino)propoxy]propan-2-amine |
|---|---|
| PubChem CID | 59834050 |
| Molecular Formula | C9H22N2O |
| Molecular Weight | 174.29 g/mol |
| Exact Mass | 174.17 |
| IUPAC Name | 1-[2-(propylamino)propoxy]propan-2-amine |
| SMILES | CCCNC(C)COCC(C)N |
| InChI | InChI=1S/C9H22N2O/c1-4-5-11-9(3)7-12-6-8(2)10/h8-9,11H,4-7,10H2,1-3H3 |
| InChIKey | MYHJLXZBYDDLEF-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.29 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |