C5H16N2Si — CID 173131158
1-N'-propylsilylethane-1,1-diamine (PubChem CID 173131158) has the molecular formula C5H16N2Si and a molecular weight of 132.28 g/mol. Its IUPAC name is 1-N'-propylsilylethane-1,1-diamine.
| Compound Name | 1-N'-propylsilylethane-1,1-diamine |
|---|---|
| PubChem CID | 173131158 |
| Molecular Formula | C5H16N2Si |
| Molecular Weight | 132.28 g/mol |
| Exact Mass | 132.11 |
| IUPAC Name | 1-N'-propylsilylethane-1,1-diamine |
| SMILES | CCC[SiH2]NC(C)N |
| InChI | InChI=1S/C5H16N2Si/c1-3-4-8-7-5(2)6/h5,7H,3-4,6,8H2,1-2H3 |
| InChIKey | NIPLBFRNEBXKCM-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.28 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|