About N-methylpentan-2-amine;hydrochloride
N-methylpentan-2-amine;hydrochloride (PubChem CID 42919600) has the molecular formula C6H16ClN
and a molecular weight of 137.65 g/mol. Its IUPAC name is N-methylpentan-2-amine;hydrochloride.
Molecular Properties
| Compound Name | N-methylpentan-2-amine;hydrochloride |
| PubChem CID | 42919600 |
| Molecular Formula | C6H16ClN |
| Molecular Weight | 137.65 g/mol |
| Exact Mass | 137.10 |
| IUPAC Name | N-methylpentan-2-amine;hydrochloride |
| SMILES | CCCC(C)NC.Cl |
| InChI | InChI=1S/C6H15N.ClH/c1-4-5-6(2)7-3;/h6-7H,4-5H2,1-3H3;1H |
| InChIKey | AOMLOTWGVLUDQZ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.65 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-methylpentan-2-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylpentan-2-amine;hydrochloride?
The IUPAC name of N-methylpentan-2-amine;hydrochloride (CID 42919600) is N-methylpentan-2-amine;hydrochloride.
What is the SMILES notation for N-methylpentan-2-amine;hydrochloride?
The canonical SMILES for N-methylpentan-2-amine;hydrochloride is CCCC(C)NC.Cl.
What is the InChIKey of N-methylpentan-2-amine;hydrochloride?
The InChIKey is AOMLOTWGVLUDQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N.ClH/c1-4-5-6(2)7-3;/h6-7H,4-5H2,1-3H3;1H.
What are the key properties of N-methylpentan-2-amine;hydrochloride?
N-methylpentan-2-amine;hydrochloride has a molecular weight of 137.65 g/mol, XLogP of 1.82, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylpentan-2-amine;hydrochloride is sourced from PubChem (CID 42919600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).