C10H24N2 — CID 92556919
1,2-bis[(2S)-pentan-2-yl]hydrazine (PubChem CID 92556919) has the molecular formula C10H24N2 and a molecular weight of 172.32 g/mol. Its IUPAC name is 1,2-bis[(2S)-pentan-2-yl]hydrazine.
| Compound Name | 1,2-bis[(2S)-pentan-2-yl]hydrazine |
|---|---|
| PubChem CID | 92556919 |
| Molecular Formula | C10H24N2 |
| Molecular Weight | 172.32 g/mol |
| Exact Mass | 172.19 |
| IUPAC Name | 1,2-bis[(2S)-pentan-2-yl]hydrazine |
| SMILES | CCC[C@H](C)NN[C@@H](C)CCC |
| InChI | InChI=1S/C10H24N2/c1-5-7-9(3)11-12-10(4)8-6-2/h9-12H,5-8H2,1-4H3/t9-,10-/m0/s1 |
| InChIKey | SAWUZIDHLBHWDT-UWVGGRQHSA-N |
| XLogP | 2.46 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.32 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|