C15H33N — CID 144521968
cyclohexane;N,4-dimethylheptan-2-amine (PubChem CID 144521968) has the molecular formula C15H33N and a molecular weight of 227.44 g/mol. Its IUPAC name is cyclohexane;N,4-dimethylheptan-2-amine.
| Compound Name | cyclohexane;N,4-dimethylheptan-2-amine |
|---|---|
| PubChem CID | 144521968 |
| Molecular Formula | C15H33N |
| Molecular Weight | 227.44 g/mol |
| Exact Mass | 227.26 |
| IUPAC Name | cyclohexane;N,4-dimethylheptan-2-amine |
| SMILES | C1CCCCC1.CCCC(C)CC(C)NC |
| InChI | InChI=1S/C9H21N.C6H12/c1-5-6-8(2)7-9(3)10-4;1-2-4-6-5-3-1/h8-10H,5-7H2,1-4H3;1-6H2 |
| InChIKey | WIJAUSUPJZOAKK-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.44 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |