C23H50N2 — CID 170105864
2-N,4,5,6-tetramethyl-8-N,5-di(pentan-2-yl)nonane-2,8-diamine (PubChem CID 170105864) has the molecular formula C23H50N2 and a molecular weight of 354.67 g/mol. Its IUPAC name is 2-N,4,5,6-tetramethyl-8-N,5-di(pentan-2-yl)nonane-2,8-diamine.
| Compound Name | 2-N,4,5,6-tetramethyl-8-N,5-di(pentan-2-yl)nonane-2,8-diamine |
|---|---|
| PubChem CID | 170105864 |
| Molecular Formula | C23H50N2 |
| Molecular Weight | 354.67 g/mol |
| Exact Mass | 354.40 |
| IUPAC Name | 2-N,4,5,6-tetramethyl-8-N,5-di(pentan-2-yl)nonane-2,8-diamine |
| SMILES | CCCC(C)NC(C)CC(C)C(C)(C(C)CCC)C(C)CC(C)NC |
| InChI | InChI=1S/C23H50N2/c1-11-13-17(3)23(9,18(4)15-21(7)24-10)19(5)16-22(8)25-20(6)14-12-2/h17-22,24-25H,11-16H2,1-10H3 |
| InChIKey | LUYHXBADADALJJ-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.67 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |