About butane;ethane;N-methylbutan-2-amine
butane;ethane;N-methylbutan-2-amine (PubChem CID 145323571) has the molecular formula C13H35N
and a molecular weight of 205.43 g/mol. Its IUPAC name is butane;ethane;N-methylbutan-2-amine.
Molecular Properties
| Compound Name | butane;ethane;N-methylbutan-2-amine |
| PubChem CID | 145323571 |
| Molecular Formula | C13H35N |
| Molecular Weight | 205.43 g/mol |
| Exact Mass | 205.28 |
| IUPAC Name | butane;ethane;N-methylbutan-2-amine |
| SMILES | CC.CC.CCC(C)NC.CCCC |
| InChI | InChI=1S/C5H13N.C4H10.2C2H6/c1-4-5(2)6-3;1-3-4-2;2*1-2/h5-6H,4H2,1-3H3;3-4H2,1-2H3;2*1-2H3 |
| InChIKey | GBMZEMQYMVVDAJ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.43 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze butane;ethane;N-methylbutan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;ethane;N-methylbutan-2-amine?
The IUPAC name of butane;ethane;N-methylbutan-2-amine (CID 145323571) is butane;ethane;N-methylbutan-2-amine.
What is the SMILES notation for butane;ethane;N-methylbutan-2-amine?
The canonical SMILES for butane;ethane;N-methylbutan-2-amine is CC.CC.CCC(C)NC.CCCC.
What is the InChIKey of butane;ethane;N-methylbutan-2-amine?
The InChIKey is GBMZEMQYMVVDAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13N.C4H10.2C2H6/c1-4-5(2)6-3;1-3-4-2;2*1-2/h5-6H,4H2,1-3H3;3-4H2,1-2H3;2*1-2H3.
What are the key properties of butane;ethane;N-methylbutan-2-amine?
butane;ethane;N-methylbutan-2-amine has a molecular weight of 205.43 g/mol, XLogP of 4.86, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for butane;ethane;N-methylbutan-2-amine is sourced from PubChem (CID 145323571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).