C7H21FN2 — CID 158321019
CID 158321019 (PubChem CID 158321019) has the molecular formula C7H21FN2 and a molecular weight of 154.27 g/mol.
| Compound Name | CID 158321019 |
|---|---|
| PubChem CID | 158321019 |
| Molecular Formula | C7H21FN2 |
| Molecular Weight | 154.27 g/mol |
| Exact Mass | 154.18 |
| IUPAC Name | — |
| SMILES | C.CC(C)NCCCN.[3H]F |
| InChI | InChI=1S/C6H16N2.CH4.FH/c1-6(2)8-5-3-4-7;;/h6,8H,3-5,7H2,1-2H3;1H4;1H/i/hT |
| InChIKey | GOVRYYGBXCEYSS-MNYXATJNSA-N |
| XLogP | 1.12 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.27 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|