C11H29N5 — CID 87748300
N'-[2-[2-[2-(propan-2-ylamino)ethylamino]ethylamino]ethyl]ethane-1,2-diamine (PubChem CID 87748300) has the molecular formula C11H29N5 and a molecular weight of 231.39 g/mol. Its IUPAC name is N'-[2-[2-[2-(propan-2-ylamino)ethylamino]ethylamino]ethyl]ethane-1,2-diamine.
| Compound Name | N'-[2-[2-[2-(propan-2-ylamino)ethylamino]ethylamino]ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 87748300 |
| Molecular Formula | C11H29N5 |
| Molecular Weight | 231.39 g/mol |
| Exact Mass | 231.24 |
| IUPAC Name | N'-[2-[2-[2-(propan-2-ylamino)ethylamino]ethylamino]ethyl]ethane-1,2-diamine |
| SMILES | CC(C)NCCNCCNCCNCCN |
| InChI | InChI=1S/C11H29N5/c1-11(2)16-10-9-15-8-7-14-6-5-13-4-3-12/h11,13-16H,3-10,12H2,1-2H3 |
| InChIKey | CCPRTAOYVUPTFU-UHFFFAOYSA-N |
| XLogP | -1.29 |
| TPSA | 74.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.39 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|