C8H23N5 — CID 18468827
1-N-(2-aminoethyl)-1-N'-[2-(2-aminoethylamino)ethyl]ethane-1,1-diamine (PubChem CID 18468827) has the molecular formula C8H23N5 and a molecular weight of 189.31 g/mol. Its IUPAC name is 1-N-(2-aminoethyl)-1-N'-[2-(2-aminoethylamino)ethyl]ethane-1,1-diamine.
| Compound Name | 1-N-(2-aminoethyl)-1-N'-[2-(2-aminoethylamino)ethyl]ethane-1,1-diamine |
|---|---|
| PubChem CID | 18468827 |
| Molecular Formula | C8H23N5 |
| Molecular Weight | 189.31 g/mol |
| Exact Mass | 189.20 |
| IUPAC Name | 1-N-(2-aminoethyl)-1-N'-[2-(2-aminoethylamino)ethyl]ethane-1,1-diamine |
| SMILES | CC(NCCN)NCCNCCN |
| InChI | InChI=1S/C8H23N5/c1-8(12-5-3-10)13-7-6-11-4-2-9/h8,11-13H,2-7,9-10H2,1H3 |
| InChIKey | AZQOZOBAHPRZFE-UHFFFAOYSA-N |
| XLogP | -1.98 |
| TPSA | 88.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.31 |
| LogP ≤ 5 | -1.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|