C4H11IN2 — CID 89021038
N'-(1-iodoethyl)ethane-1,2-diamine (PubChem CID 89021038) has the molecular formula C4H11IN2 and a molecular weight of 214.05 g/mol. Its IUPAC name is N'-(1-iodoethyl)ethane-1,2-diamine.
| Compound Name | N'-(1-iodoethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 89021038 |
| Molecular Formula | C4H11IN2 |
| Molecular Weight | 214.05 g/mol |
| Exact Mass | 214.00 |
| IUPAC Name | N'-(1-iodoethyl)ethane-1,2-diamine |
| SMILES | CC(I)NCCN |
| InChI | InChI=1S/C4H11IN2/c1-4(5)7-3-2-6/h4,7H,2-3,6H2,1H3 |
| InChIKey | ACNBQAIQDOZSPV-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.05 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|