C5H12F2N2 — CID 102869079
N'-(1,1-difluoropropan-2-yl)ethane-1,2-diamine (PubChem CID 102869079) has the molecular formula C5H12F2N2 and a molecular weight of 138.16 g/mol. Its IUPAC name is N'-(1,1-difluoropropan-2-yl)ethane-1,2-diamine.
| Compound Name | N'-(1,1-difluoropropan-2-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 102869079 |
| Molecular Formula | C5H12F2N2 |
| Molecular Weight | 138.16 g/mol |
| Exact Mass | 138.10 |
| IUPAC Name | N'-(1,1-difluoropropan-2-yl)ethane-1,2-diamine |
| SMILES | CC(NCCN)C(F)F |
| InChI | InChI=1S/C5H12F2N2/c1-4(5(6)7)9-3-2-8/h4-5,9H,2-3,8H2,1H3 |
| InChIKey | CRJFMGUBTVWYPP-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.16 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |