C8H13F2N — CID 102870139
N-(1,1-difluoropropan-2-yl)pent-3-yn-1-amine (PubChem CID 102870139) has the molecular formula C8H13F2N and a molecular weight of 161.19 g/mol. Its IUPAC name is N-(1,1-difluoropropan-2-yl)pent-3-yn-1-amine.
| Compound Name | N-(1,1-difluoropropan-2-yl)pent-3-yn-1-amine |
|---|---|
| PubChem CID | 102870139 |
| Molecular Formula | C8H13F2N |
| Molecular Weight | 161.19 g/mol |
| Exact Mass | 161.10 |
| IUPAC Name | N-(1,1-difluoropropan-2-yl)pent-3-yn-1-amine |
| SMILES | CC#CCCNC(C)C(F)F |
| InChI | InChI=1S/C8H13F2N/c1-3-4-5-6-11-7(2)8(9)10/h7-8,11H,5-6H2,1-2H3 |
| InChIKey | WERDEQUIUISTIO-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.19 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|