C9H15F2N — CID 106209686
N-(1,1-difluoropropan-2-yl)hex-5-yn-1-amine (PubChem CID 106209686) has the molecular formula C9H15F2N and a molecular weight of 175.22 g/mol. Its IUPAC name is N-(1,1-difluoropropan-2-yl)hex-5-yn-1-amine.
| Compound Name | N-(1,1-difluoropropan-2-yl)hex-5-yn-1-amine |
|---|---|
| PubChem CID | 106209686 |
| Molecular Formula | C9H15F2N |
| Molecular Weight | 175.22 g/mol |
| Exact Mass | 175.12 |
| IUPAC Name | N-(1,1-difluoropropan-2-yl)hex-5-yn-1-amine |
| SMILES | C#CCCCCNC(C)C(F)F |
| InChI | InChI=1S/C9H15F2N/c1-3-4-5-6-7-12-8(2)9(10)11/h1,8-9,12H,4-7H2,2H3 |
| InChIKey | AJHNKPMCSNCDKE-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.22 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|