C11H23F2N — CID 102869921
N-(1,1-difluoropropan-2-yl)octan-1-amine (PubChem CID 102869921) has the molecular formula C11H23F2N and a molecular weight of 207.31 g/mol. Its IUPAC name is N-(1,1-difluoropropan-2-yl)octan-1-amine.
| Compound Name | N-(1,1-difluoropropan-2-yl)octan-1-amine |
|---|---|
| PubChem CID | 102869921 |
| Molecular Formula | C11H23F2N |
| Molecular Weight | 207.31 g/mol |
| Exact Mass | 207.18 |
| IUPAC Name | N-(1,1-difluoropropan-2-yl)octan-1-amine |
| SMILES | CCCCCCCCNC(C)C(F)F |
| InChI | InChI=1S/C11H23F2N/c1-3-4-5-6-7-8-9-14-10(2)11(12)13/h10-11,14H,3-9H2,1-2H3 |
| InChIKey | MFQIXSQHIKDJEL-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.31 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|