C9H19F2N — CID 102869254
N-(1,1-difluoropropan-2-yl)-4-methylpentan-1-amine (PubChem CID 102869254) has the molecular formula C9H19F2N and a molecular weight of 179.25 g/mol. Its IUPAC name is N-(1,1-difluoropropan-2-yl)-4-methylpentan-1-amine.
| Compound Name | N-(1,1-difluoropropan-2-yl)-4-methylpentan-1-amine |
|---|---|
| PubChem CID | 102869254 |
| Molecular Formula | C9H19F2N |
| Molecular Weight | 179.25 g/mol |
| Exact Mass | 179.15 |
| IUPAC Name | N-(1,1-difluoropropan-2-yl)-4-methylpentan-1-amine |
| SMILES | CC(C)CCCNC(C)C(F)F |
| InChI | InChI=1S/C9H19F2N/c1-7(2)5-4-6-12-8(3)9(10)11/h7-9,12H,4-6H2,1-3H3 |
| InChIKey | LVBPEKNKEFSMSG-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.25 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|