C6H12F2N2O — CID 102868267
3-(1,1-difluoropropan-2-ylamino)propanamide (PubChem CID 102868267) has the molecular formula C6H12F2N2O and a molecular weight of 166.17 g/mol. Its IUPAC name is 3-(1,1-difluoropropan-2-ylamino)propanamide.
| Compound Name | 3-(1,1-difluoropropan-2-ylamino)propanamide |
|---|---|
| PubChem CID | 102868267 |
| Molecular Formula | C6H12F2N2O |
| Molecular Weight | 166.17 g/mol |
| Exact Mass | 166.09 |
| IUPAC Name | 3-(1,1-difluoropropan-2-ylamino)propanamide |
| SMILES | CC(NCCC(N)=O)C(F)F |
| InChI | InChI=1S/C6H12F2N2O/c1-4(6(7)8)10-3-2-5(9)11/h4,6,10H,2-3H2,1H3,(H2,9,11) |
| InChIKey | VFBRAAQRTYHDIM-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.17 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |