C8H22N2 — CID 142992990
N'-butan-2-ylethane-1,2-diamine;ethane (PubChem CID 142992990) has the molecular formula C8H22N2 and a molecular weight of 146.28 g/mol. Its IUPAC name is N'-butan-2-ylethane-1,2-diamine;ethane.
| Compound Name | N'-butan-2-ylethane-1,2-diamine;ethane |
|---|---|
| PubChem CID | 142992990 |
| Molecular Formula | C8H22N2 |
| Molecular Weight | 146.28 g/mol |
| Exact Mass | 146.18 |
| IUPAC Name | N'-butan-2-ylethane-1,2-diamine;ethane |
| SMILES | CC.CCC(C)NCCN |
| InChI | InChI=1S/C6H16N2.C2H6/c1-3-6(2)8-5-4-7;1-2/h6,8H,3-5,7H2,1-2H3;1-2H3 |
| InChIKey | WFAUOIWFQJRYHQ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.28 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |