C8H20N2 — CID 44630785
N'-butan-2-yl-N-ethylethane-1,2-diamine (PubChem CID 44630785) has the molecular formula C8H20N2 and a molecular weight of 144.26 g/mol. Its IUPAC name is N'-butan-2-yl-N-ethylethane-1,2-diamine.
| Compound Name | N'-butan-2-yl-N-ethylethane-1,2-diamine |
|---|---|
| PubChem CID | 44630785 |
| Molecular Formula | C8H20N2 |
| Molecular Weight | 144.26 g/mol |
| Exact Mass | 144.16 |
| IUPAC Name | N'-butan-2-yl-N-ethylethane-1,2-diamine |
| SMILES | CCNCCNC(C)CC |
| InChI | InChI=1S/C8H20N2/c1-4-8(3)10-7-6-9-5-2/h8-10H,4-7H2,1-3H3 |
| InChIKey | VXXAQVYRFUHUBC-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.26 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|