About (2H)iodane;N-propylbutan-2-amine
(2H)iodane;N-propylbutan-2-amine (PubChem CID 160782338) has the molecular formula C7H18IN
and a molecular weight of 244.14 g/mol. Its IUPAC name is (2H)iodane;N-propylbutan-2-amine.
Molecular Properties
| Compound Name | (2H)iodane;N-propylbutan-2-amine |
| PubChem CID | 160782338 |
| Molecular Formula | C7H18IN |
| Molecular Weight | 244.14 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | (2H)iodane;N-propylbutan-2-amine |
| SMILES | CCCNC(C)CC.[2H]I |
| InChI | InChI=1S/C7H17N.HI/c1-4-6-8-7(3)5-2;/h7-8H,4-6H2,1-3H3;1H/i/hD |
| InChIKey | SASYAFOOYRPJRD-DYCDLGHISA-N |
| XLogP | 2.40 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.14 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (2H)iodane;N-propylbutan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2H)iodane;N-propylbutan-2-amine?
The IUPAC name of (2H)iodane;N-propylbutan-2-amine (CID 160782338) is (2H)iodane;N-propylbutan-2-amine.
What is the SMILES notation for (2H)iodane;N-propylbutan-2-amine?
The canonical SMILES for (2H)iodane;N-propylbutan-2-amine is CCCNC(C)CC.[2H]I.
What is the InChIKey of (2H)iodane;N-propylbutan-2-amine?
The InChIKey is SASYAFOOYRPJRD-DYCDLGHISA-N. The full InChI is InChI=1S/C7H17N.HI/c1-4-6-8-7(3)5-2;/h7-8H,4-6H2,1-3H3;1H/i/hD.
What are the key properties of (2H)iodane;N-propylbutan-2-amine?
(2H)iodane;N-propylbutan-2-amine has a molecular weight of 244.14 g/mol, XLogP of 2.40, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2H)iodane;N-propylbutan-2-amine is sourced from PubChem (CID 160782338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).