About 4-methylpentan-1-amine;5-(propan-2-ylamino)pentan-2-one
4-methylpentan-1-amine;5-(propan-2-ylamino)pentan-2-one (PubChem CID 161037963) has the molecular formula C14H32N2O
and a molecular weight of 244.42 g/mol. Its IUPAC name is 4-methylpentan-1-amine;5-(propan-2-ylamino)pentan-2-one.
Molecular Properties
| Compound Name | 4-methylpentan-1-amine;5-(propan-2-ylamino)pentan-2-one |
| PubChem CID | 161037963 |
| Molecular Formula | C14H32N2O |
| Molecular Weight | 244.42 g/mol |
| Exact Mass | 244.25 |
| IUPAC Name | 4-methylpentan-1-amine;5-(propan-2-ylamino)pentan-2-one |
| SMILES | CC(=O)CCCNC(C)C.CC(C)CCCN |
| InChI | InChI=1S/C8H17NO.C6H15N/c1-7(2)9-6-4-5-8(3)10;1-6(2)4-3-5-7/h7,9H,4-6H2,1-3H3;6H,3-5,7H2,1-2H3 |
| InChIKey | UAMQSSQEXOTMBU-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.42 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-methylpentan-1-amine;5-(propan-2-ylamino)pentan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylpentan-1-amine;5-(propan-2-ylamino)pentan-2-one?
The IUPAC name of 4-methylpentan-1-amine;5-(propan-2-ylamino)pentan-2-one (CID 161037963) is 4-methylpentan-1-amine;5-(propan-2-ylamino)pentan-2-one.
What is the SMILES notation for 4-methylpentan-1-amine;5-(propan-2-ylamino)pentan-2-one?
The canonical SMILES for 4-methylpentan-1-amine;5-(propan-2-ylamino)pentan-2-one is CC(=O)CCCNC(C)C.CC(C)CCCN.
What is the InChIKey of 4-methylpentan-1-amine;5-(propan-2-ylamino)pentan-2-one?
The InChIKey is UAMQSSQEXOTMBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO.C6H15N/c1-7(2)9-6-4-5-8(3)10;1-6(2)4-3-5-7/h7,9H,4-6H2,1-3H3;6H,3-5,7H2,1-2H3.
What are the key properties of 4-methylpentan-1-amine;5-(propan-2-ylamino)pentan-2-one?
4-methylpentan-1-amine;5-(propan-2-ylamino)pentan-2-one has a molecular weight of 244.42 g/mol, XLogP of 2.73, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylpentan-1-amine;5-(propan-2-ylamino)pentan-2-one is sourced from PubChem (CID 161037963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).