C11H27N3 — CID 175230718
2-methyldecane-1,1,10-triamine (PubChem CID 175230718) has the molecular formula C11H27N3 and a molecular weight of 201.36 g/mol. Its IUPAC name is 2-methyldecane-1,1,10-triamine.
| Compound Name | 2-methyldecane-1,1,10-triamine |
|---|---|
| PubChem CID | 175230718 |
| Molecular Formula | C11H27N3 |
| Molecular Weight | 201.36 g/mol |
| Exact Mass | 201.22 |
| IUPAC Name | 2-methyldecane-1,1,10-triamine |
| SMILES | CC(CCCCCCCCN)C(N)N |
| InChI | InChI=1S/C11H27N3/c1-10(11(13)14)8-6-4-2-3-5-7-9-12/h10-11H,2-9,12-14H2,1H3 |
| InChIKey | CNLIKGOPVSRISP-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.36 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|