About 2,4-dimethylhexane-1,6-diamine;ethane
2,4-dimethylhexane-1,6-diamine;ethane (PubChem CID 142019554) has the molecular formula C10H26N2
and a molecular weight of 174.33 g/mol. Its IUPAC name is 2,4-dimethylhexane-1,6-diamine;ethane.
Molecular Properties
| Compound Name | 2,4-dimethylhexane-1,6-diamine;ethane |
| PubChem CID | 142019554 |
| Molecular Formula | C10H26N2 |
| Molecular Weight | 174.33 g/mol |
| Exact Mass | 174.21 |
| IUPAC Name | 2,4-dimethylhexane-1,6-diamine;ethane |
| SMILES | CC.CC(CN)CC(C)CCN |
| InChI | InChI=1S/C8H20N2.C2H6/c1-7(3-4-9)5-8(2)6-10;1-2/h7-8H,3-6,9-10H2,1-2H3;1-2H3 |
| InChIKey | ABHHLJYGQPUOAS-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.33 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,4-dimethylhexane-1,6-diamine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethylhexane-1,6-diamine;ethane?
The IUPAC name of 2,4-dimethylhexane-1,6-diamine;ethane (CID 142019554) is 2,4-dimethylhexane-1,6-diamine;ethane.
What is the SMILES notation for 2,4-dimethylhexane-1,6-diamine;ethane?
The canonical SMILES for 2,4-dimethylhexane-1,6-diamine;ethane is CC.CC(CN)CC(C)CCN.
What is the InChIKey of 2,4-dimethylhexane-1,6-diamine;ethane?
The InChIKey is ABHHLJYGQPUOAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H20N2.C2H6/c1-7(3-4-9)5-8(2)6-10;1-2/h7-8H,3-6,9-10H2,1-2H3;1-2H3.
What are the key properties of 2,4-dimethylhexane-1,6-diamine;ethane?
2,4-dimethylhexane-1,6-diamine;ethane has a molecular weight of 174.33 g/mol, XLogP of 1.98, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethylhexane-1,6-diamine;ethane is sourced from PubChem (CID 142019554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).