C10H26N2 — CID 142019554
2,4-dimethylhexane-1,6-diamine;ethane (PubChem CID 142019554) has the molecular formula C10H26N2 and a molecular weight of 174.33 g/mol. Its IUPAC name is 2,4-dimethylhexane-1,6-diamine;ethane.
| Compound Name | 2,4-dimethylhexane-1,6-diamine;ethane |
|---|---|
| PubChem CID | 142019554 |
| Molecular Formula | C10H26N2 |
| Molecular Weight | 174.33 g/mol |
| Exact Mass | 174.21 |
| IUPAC Name | 2,4-dimethylhexane-1,6-diamine;ethane |
| SMILES | CC.CC(CN)CC(C)CCN |
| InChI | InChI=1S/C8H20N2.C2H6/c1-7(3-4-9)5-8(2)6-10;1-2/h7-8H,3-6,9-10H2,1-2H3;1-2H3 |
| InChIKey | ABHHLJYGQPUOAS-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.33 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |