About 1,7-dibromo-3,5-dimethylheptane
1,7-dibromo-3,5-dimethylheptane (PubChem CID 155037332) has the molecular formula C9H18Br2
and a molecular weight of 286.05 g/mol. Its IUPAC name is 1,7-dibromo-3,5-dimethylheptane.
Molecular Properties
| Compound Name | 1,7-dibromo-3,5-dimethylheptane |
| PubChem CID | 155037332 |
| Molecular Formula | C9H18Br2 |
| Molecular Weight | 286.05 g/mol |
| Exact Mass | 283.98 |
| IUPAC Name | 1,7-dibromo-3,5-dimethylheptane |
| SMILES | CC(CCBr)CC(C)CCBr |
| InChI | InChI=1S/C9H18Br2/c1-8(3-5-10)7-9(2)4-6-11/h8-9H,3-7H2,1-2H3 |
| InChIKey | RBIXRQPDMYLXQM-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.05 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1,7-dibromo-3,5-dimethylheptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,7-dibromo-3,5-dimethylheptane?
The IUPAC name of 1,7-dibromo-3,5-dimethylheptane (CID 155037332) is 1,7-dibromo-3,5-dimethylheptane.
What is the SMILES notation for 1,7-dibromo-3,5-dimethylheptane?
The canonical SMILES for 1,7-dibromo-3,5-dimethylheptane is CC(CCBr)CC(C)CCBr.
What is the InChIKey of 1,7-dibromo-3,5-dimethylheptane?
The InChIKey is RBIXRQPDMYLXQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18Br2/c1-8(3-5-10)7-9(2)4-6-11/h8-9H,3-7H2,1-2H3.
What are the key properties of 1,7-dibromo-3,5-dimethylheptane?
1,7-dibromo-3,5-dimethylheptane has a molecular weight of 286.05 g/mol, XLogP of 4.22, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,7-dibromo-3,5-dimethylheptane is sourced from PubChem (CID 155037332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).