C9H18Br2 — CID 155037332
1,7-dibromo-3,5-dimethylheptane (PubChem CID 155037332) has the molecular formula C9H18Br2 and a molecular weight of 286.05 g/mol. Its IUPAC name is 1,7-dibromo-3,5-dimethylheptane.
| Compound Name | 1,7-dibromo-3,5-dimethylheptane |
|---|---|
| PubChem CID | 155037332 |
| Molecular Formula | C9H18Br2 |
| Molecular Weight | 286.05 g/mol |
| Exact Mass | 283.98 |
| IUPAC Name | 1,7-dibromo-3,5-dimethylheptane |
| SMILES | CC(CCBr)CC(C)CCBr |
| InChI | InChI=1S/C9H18Br2/c1-8(3-5-10)7-9(2)4-6-11/h8-9H,3-7H2,1-2H3 |
| InChIKey | RBIXRQPDMYLXQM-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.05 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|