About 1-bromo-5,7-dimethylundecane
1-bromo-5,7-dimethylundecane (PubChem CID 72965609) has the molecular formula C13H27Br
and a molecular weight of 263.26 g/mol. Its IUPAC name is 1-bromo-5,7-dimethylundecane.
Molecular Properties
| Compound Name | 1-bromo-5,7-dimethylundecane |
| PubChem CID | 72965609 |
| Molecular Formula | C13H27Br |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 1-bromo-5,7-dimethylundecane |
| SMILES | CCCCC(C)CC(C)CCCCBr |
| InChI | InChI=1S/C13H27Br/c1-4-5-8-12(2)11-13(3)9-6-7-10-14/h12-13H,4-11H2,1-3H3 |
| InChIKey | AJQYHVRTIWDMQG-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-5,7-dimethylundecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-5,7-dimethylundecane?
The IUPAC name of 1-bromo-5,7-dimethylundecane (CID 72965609) is 1-bromo-5,7-dimethylundecane.
What is the SMILES notation for 1-bromo-5,7-dimethylundecane?
The canonical SMILES for 1-bromo-5,7-dimethylundecane is CCCCC(C)CC(C)CCCCBr.
What is the InChIKey of 1-bromo-5,7-dimethylundecane?
The InChIKey is AJQYHVRTIWDMQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27Br/c1-4-5-8-12(2)11-13(3)9-6-7-10-14/h12-13H,4-11H2,1-3H3.
What are the key properties of 1-bromo-5,7-dimethylundecane?
1-bromo-5,7-dimethylundecane has a molecular weight of 263.26 g/mol, XLogP of 5.40, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-5,7-dimethylundecane is sourced from PubChem (CID 72965609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).