About (3R)-1-bromo-3,11-dimethyldodecane
(3R)-1-bromo-3,11-dimethyldodecane (PubChem CID 118054379) has the molecular formula C14H29Br
and a molecular weight of 277.29 g/mol. Its IUPAC name is (3R)-1-bromo-3,11-dimethyldodecane.
Molecular Properties
| Compound Name | (3R)-1-bromo-3,11-dimethyldodecane |
| PubChem CID | 118054379 |
| Molecular Formula | C14H29Br |
| Molecular Weight | 277.29 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | (3R)-1-bromo-3,11-dimethyldodecane |
| SMILES | CC(C)CCCCCCC[C@@H](C)CCBr |
| InChI | InChI=1S/C14H29Br/c1-13(2)9-7-5-4-6-8-10-14(3)11-12-15/h13-14H,4-12H2,1-3H3/t14-/m1/s1 |
| InChIKey | FCCRKZVRRSCSTH-CQSZACIVSA-N |
| XLogP | 5.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 277.29 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (3R)-1-bromo-3,11-dimethyldodecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-1-bromo-3,11-dimethyldodecane?
The IUPAC name of (3R)-1-bromo-3,11-dimethyldodecane (CID 118054379) is (3R)-1-bromo-3,11-dimethyldodecane.
What is the SMILES notation for (3R)-1-bromo-3,11-dimethyldodecane?
The canonical SMILES for (3R)-1-bromo-3,11-dimethyldodecane is CC(C)CCCCCCC[C@@H](C)CCBr.
What is the InChIKey of (3R)-1-bromo-3,11-dimethyldodecane?
The InChIKey is FCCRKZVRRSCSTH-CQSZACIVSA-N. The full InChI is InChI=1S/C14H29Br/c1-13(2)9-7-5-4-6-8-10-14(3)11-12-15/h13-14H,4-12H2,1-3H3/t14-/m1/s1.
What are the key properties of (3R)-1-bromo-3,11-dimethyldodecane?
(3R)-1-bromo-3,11-dimethyldodecane has a molecular weight of 277.29 g/mol, XLogP of 5.79, 10 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-1-bromo-3,11-dimethyldodecane is sourced from PubChem (CID 118054379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).