C3H10N2O — CID 10419133
1,3-diaminopropan-1-ol (PubChem CID 10419133) has the molecular formula C3H10N2O and a molecular weight of 90.13 g/mol. Its IUPAC name is 1,3-diaminopropan-1-ol.
| Compound Name | 1,3-diaminopropan-1-ol |
|---|---|
| PubChem CID | 10419133 |
| Molecular Formula | C3H10N2O |
| Molecular Weight | 90.13 g/mol |
| Exact Mass | 90.08 |
| IUPAC Name | 1,3-diaminopropan-1-ol |
| SMILES | NCCC(N)O |
| InChI | InChI=1S/C3H10N2O/c4-2-1-3(5)6/h3,6H,1-2,4-5H2 |
| InChIKey | MRHPRDYMSACWSG-UHFFFAOYSA-N |
| XLogP | -1.39 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 90.13 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|