(2R,3S)-2,5-diamino-3-hydroxypentanoic acid

C5H12N2O3 — CID 14780344

IUPAC(2R,3S)-2,5-diamino-3-hydroxypentanoic acid
SMILESNCC[C@H](O)[C@@H](N)C(=O)O
InChIInChI=1S/C5H12N2O3/c6-2-1-3(8)4(7)5(9)10/h3-4,8H,1-2,6-7H2,(H,9,10)/t3-,4+/m0/s1
InChIKeyUHPDQDWXMXBLRX-IUYQGCFVSA-N
MW148.16 g/mol
LogP-1.89
Rot. Bonds4

About (2R,3S)-2,5-diamino-3-hydroxypentanoic acid

(2R,3S)-2,5-diamino-3-hydroxypentanoic acid (PubChem CID 14780344) has the molecular formula C5H12N2O3 and a molecular weight of 148.16 g/mol. Its IUPAC name is (2R,3S)-2,5-diamino-3-hydroxypentanoic acid.

Molecular Properties

Compound Name(2R,3S)-2,5-diamino-3-hydroxypentanoic acid
PubChem CID14780344
Molecular FormulaC5H12N2O3
Molecular Weight148.16 g/mol
Exact Mass148.08
IUPAC Name(2R,3S)-2,5-diamino-3-hydroxypentanoic acid
SMILESNCC[C@H](O)[C@@H](N)C(=O)O
InChIInChI=1S/C5H12N2O3/c6-2-1-3(8)4(7)5(9)10/h3-4,8H,1-2,6-7H2,(H,9,10)/t3-,4+/m0/s1
InChIKeyUHPDQDWXMXBLRX-IUYQGCFVSA-N
XLogP-1.89
TPSA109.57 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500148.16
LogP ≤ 5-1.89
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Analyze (2R,3S)-2,5-diamino-3-hydroxypentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

(2S,3S)-2-amino-3-hydroxy-6-methylheptanoic acid
CID 154251758
(2S)-2-amino-3-hydroxyheptanoic acid
CID 139775906
(2S,3S)-2-amino-3-hydroxy-4-phosphanylbutanoic acid
CID 87416612
(2S,3R)-2-amino-4-bromo-3-hydroxybutanoic acid
CID 130737323
2,4-diaminobutanoic acid
CID 158725018
2-amino-5-ethylsulfanyl-3-hydroxypentanoic acid
CID 116504445
(2S)-2-amino-3-hydroxypentanoic acid;hydrochloride
CID 87786903
(2S,3R)-2-amino-5-deuterio-5-(diaminomethylideneamino)-3-hydroxypentanoic acid
CID 132839361
(2S,3S)-2-amino-5-cyclohexyl-3-hydroxypentanoic acid
CID 157381240
(2S)-2-amino-3-carbamoyl-4-hydroxyheptanoic acid
CID 146277637
(2S,3S)-2,6-diamino-3-methylhexanoic acid
CID 147560820
(2S,3S,4S)-2-amino-3,4,5-trihydroxypentanoic acid
CID 11126623

Frequently Asked Questions

What is the IUPAC name of (2R,3S)-2,5-diamino-3-hydroxypentanoic acid?
The IUPAC name of (2R,3S)-2,5-diamino-3-hydroxypentanoic acid (CID 14780344) is (2R,3S)-2,5-diamino-3-hydroxypentanoic acid.
What is the SMILES notation for (2R,3S)-2,5-diamino-3-hydroxypentanoic acid?
The canonical SMILES for (2R,3S)-2,5-diamino-3-hydroxypentanoic acid is NCC[C@H](O)[C@@H](N)C(=O)O.
What is the InChIKey of (2R,3S)-2,5-diamino-3-hydroxypentanoic acid?
The InChIKey is UHPDQDWXMXBLRX-IUYQGCFVSA-N. The full InChI is InChI=1S/C5H12N2O3/c6-2-1-3(8)4(7)5(9)10/h3-4,8H,1-2,6-7H2,(H,9,10)/t3-,4+/m0/s1.
What are the key properties of (2R,3S)-2,5-diamino-3-hydroxypentanoic acid?
(2R,3S)-2,5-diamino-3-hydroxypentanoic acid has a molecular weight of 148.16 g/mol, XLogP of -1.89, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3S)-2,5-diamino-3-hydroxypentanoic acid is sourced from PubChem (CID 14780344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).