C6H14N4O3 — CID 132839361
(2S,3R)-2-amino-5-deuterio-5-(diaminomethylideneamino)-3-hydroxypentanoic acid (PubChem CID 132839361) has the molecular formula C6H14N4O3 and a molecular weight of 191.21 g/mol. Its IUPAC name is (2S,3R)-2-amino-5-deuterio-5-(diaminomethylideneamino)-3-hydroxypentanoic acid.
| Compound Name | (2S,3R)-2-amino-5-deuterio-5-(diaminomethylideneamino)-3-hydroxypentanoic acid |
|---|---|
| PubChem CID | 132839361 |
| Molecular Formula | C6H14N4O3 |
| Molecular Weight | 191.21 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | (2S,3R)-2-amino-5-deuterio-5-(diaminomethylideneamino)-3-hydroxypentanoic acid |
| SMILES | [2H]C(C[C@@H](O)[C@H](N)C(=O)O)N=C(N)N |
| InChI | InChI=1S/C6H14N4O3/c7-4(5(12)13)3(11)1-2-10-6(8)9/h3-4,11H,1-2,7H2,(H,12,13)(H4,8,9,10)/t3-,4+/m1/s1/i2D/t2?,3-,4+ |
| InChIKey | VIDUVSPOWYVZIC-QQUHPPKPSA-N |
| XLogP | -2.58 |
| TPSA | 147.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.21 |
| LogP ≤ 5 | -2.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|