C6H14N4O3 — CID 71448989
(2S)-2-amino-5-(diaminomethylideneamino)-5-hydroxypentanoic acid (PubChem CID 71448989) has the molecular formula C6H14N4O3 and a molecular weight of 190.20 g/mol. Its IUPAC name is (2S)-2-amino-5-(diaminomethylideneamino)-5-hydroxypentanoic acid.
| Compound Name | (2S)-2-amino-5-(diaminomethylideneamino)-5-hydroxypentanoic acid |
|---|---|
| PubChem CID | 71448989 |
| Molecular Formula | C6H14N4O3 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | (2S)-2-amino-5-(diaminomethylideneamino)-5-hydroxypentanoic acid |
| SMILES | NC(N)=NC(O)CC[C@H](N)C(=O)O |
| InChI | InChI=1S/C6H14N4O3/c7-3(5(12)13)1-2-4(11)10-6(8)9/h3-4,11H,1-2,7H2,(H,12,13)(H4,8,9,10)/t3-,4?/m0/s1 |
| InChIKey | WWURQGFETAMJQN-WUCPZUCCSA-N |
| XLogP | -2.23 |
| TPSA | 147.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | -2.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|