C7H18N8O2 — CID 174735691
2-amino-5-[[amino(hydrazinyl)methylidene]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 174735691) has the molecular formula C7H18N8O2 and a molecular weight of 246.27 g/mol. Its IUPAC name is 2-amino-5-[[amino(hydrazinyl)methylidene]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | 2-amino-5-[[amino(hydrazinyl)methylidene]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 174735691 |
| Molecular Formula | C7H18N8O2 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | 2-amino-5-[[amino(hydrazinyl)methylidene]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | NNC(N)=NC(CCC(N)C(=O)O)N=C(N)N |
| InChI | InChI=1S/C7H18N8O2/c8-3(5(16)17)1-2-4(13-6(9)10)14-7(11)15-12/h3-4H,1-2,8,12H2,(H,16,17)(H4,9,10,13)(H3,11,14,15) |
| InChIKey | UEMOGJZPPRRMLH-UHFFFAOYSA-N |
| XLogP | -3.44 |
| TPSA | 204.15 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | -3.44 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|