C11H18F6N4O6 — CID 23657389
(2S,5S)-2-amino-5-(diaminomethylideneamino)hexanoic acid;bis(2,2,2-trifluoroacetic acid) (PubChem CID 23657389) has the molecular formula C11H18F6N4O6 and a molecular weight of 416.28 g/mol. Its IUPAC name is (2S,5S)-2-amino-5-(diaminomethylideneamino)hexanoic acid;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (2S,5S)-2-amino-5-(diaminomethylideneamino)hexanoic acid;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 23657389 |
| Molecular Formula | C11H18F6N4O6 |
| Molecular Weight | 416.28 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | (2S,5S)-2-amino-5-(diaminomethylideneamino)hexanoic acid;bis(2,2,2-trifluoroacetic acid) |
| SMILES | C[C@@H](CC[C@H](N)C(=O)O)N=C(N)N.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C7H16N4O2.2C2HF3O2/c1-4(11-7(9)10)2-3-5(8)6(12)13;2*3-2(4,5)1(6)7/h4-5H,2-3,8H2,1H3,(H,12,13)(H4,9,10,11);2*(H,6,7)/t4-,5-;;/m0../s1 |
| InChIKey | QFQQVZSICBHIQP-RSLHMRQOSA-N |
| XLogP | 0.11 |
| TPSA | 202.32 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.28 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|