C8H12F3NO4 — CID 178040034
(2S)-2-amino-5-(2,2,2-trifluoroacetyl)oxyhexanoic acid (PubChem CID 178040034) has the molecular formula C8H12F3NO4 and a molecular weight of 243.18 g/mol. Its IUPAC name is (2S)-2-amino-5-(2,2,2-trifluoroacetyl)oxyhexanoic acid.
| Compound Name | (2S)-2-amino-5-(2,2,2-trifluoroacetyl)oxyhexanoic acid |
|---|---|
| PubChem CID | 178040034 |
| Molecular Formula | C8H12F3NO4 |
| Molecular Weight | 243.18 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | (2S)-2-amino-5-(2,2,2-trifluoroacetyl)oxyhexanoic acid |
| SMILES | CC(CC[C@H](N)C(=O)O)OC(=O)C(F)(F)F |
| InChI | InChI=1S/C8H12F3NO4/c1-4(2-3-5(12)6(13)14)16-7(15)8(9,10)11/h4-5H,2-3,12H2,1H3,(H,13,14)/t4?,5-/m0/s1 |
| InChIKey | QVGUIQFLXVCYDD-AKGZTFGVSA-N |
| XLogP | 0.67 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.18 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |