C4H10N4O2 — CID 142796198
(2S)-2-[[amino(hydrazinyl)methylidene]amino]propanoic acid (PubChem CID 142796198) has the molecular formula C4H10N4O2 and a molecular weight of 146.15 g/mol. Its IUPAC name is (2S)-2-[[amino(hydrazinyl)methylidene]amino]propanoic acid.
| Compound Name | (2S)-2-[[amino(hydrazinyl)methylidene]amino]propanoic acid |
|---|---|
| PubChem CID | 142796198 |
| Molecular Formula | C4H10N4O2 |
| Molecular Weight | 146.15 g/mol |
| Exact Mass | 146.08 |
| IUPAC Name | (2S)-2-[[amino(hydrazinyl)methylidene]amino]propanoic acid |
| SMILES | C[C@H](/N=C(\N)NN)C(=O)O |
| InChI | InChI=1S/C4H10N4O2/c1-2(3(9)10)7-4(5)8-6/h2H,6H2,1H3,(H,9,10)(H3,5,7,8)/t2-/m0/s1 |
| InChIKey | UDTGINZOFZKUEP-REOHCLBHSA-N |
| XLogP | -1.76 |
| TPSA | 113.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.15 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|