C5H13N5O — CID 104870450
3-[[amino(hydrazinyl)methylidene]amino]butanamide (PubChem CID 104870450) has the molecular formula C5H13N5O and a molecular weight of 159.19 g/mol. Its IUPAC name is 3-[[amino(hydrazinyl)methylidene]amino]butanamide.
| Compound Name | 3-[[amino(hydrazinyl)methylidene]amino]butanamide |
|---|---|
| PubChem CID | 104870450 |
| Molecular Formula | C5H13N5O |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.11 |
| IUPAC Name | 3-[[amino(hydrazinyl)methylidene]amino]butanamide |
| SMILES | CC(CC(N)=O)/N=C(\N)NN |
| InChI | InChI=1S/C5H13N5O/c1-3(2-4(6)11)9-5(7)10-8/h3H,2,8H2,1H3,(H2,6,11)(H3,7,9,10) |
| InChIKey | JXAUDGIWBXNPJB-UHFFFAOYSA-N |
| XLogP | -1.97 |
| TPSA | 119.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | -1.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|