C8H16N4O4 — CID 175233905
diethyl 2-[[amino(hydrazinyl)methylidene]amino]propanedioate (PubChem CID 175233905) has the molecular formula C8H16N4O4 and a molecular weight of 232.24 g/mol. Its IUPAC name is diethyl 2-[[amino(hydrazinyl)methylidene]amino]propanedioate.
| Compound Name | diethyl 2-[[amino(hydrazinyl)methylidene]amino]propanedioate |
|---|---|
| PubChem CID | 175233905 |
| Molecular Formula | C8H16N4O4 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | diethyl 2-[[amino(hydrazinyl)methylidene]amino]propanedioate |
| SMILES | CCOC(=O)C(/N=C(\N)NN)C(=O)OCC |
| InChI | InChI=1S/C8H16N4O4/c1-3-15-6(13)5(7(14)16-4-2)11-8(9)12-10/h5H,3-4,10H2,1-2H3,(H3,9,11,12) |
| InChIKey | CPMADVPLPOVACC-UHFFFAOYSA-N |
| XLogP | -1.74 |
| TPSA | 129.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|