C9H17N3O4 — CID 143710214
2-[[amino-(ethoxycarbonylamino)methylidene]amino]pentanoic acid (PubChem CID 143710214) has the molecular formula C9H17N3O4 and a molecular weight of 231.25 g/mol. Its IUPAC name is 2-[[amino-(ethoxycarbonylamino)methylidene]amino]pentanoic acid.
| Compound Name | 2-[[amino-(ethoxycarbonylamino)methylidene]amino]pentanoic acid |
|---|---|
| PubChem CID | 143710214 |
| Molecular Formula | C9H17N3O4 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.12 |
| IUPAC Name | 2-[[amino-(ethoxycarbonylamino)methylidene]amino]pentanoic acid |
| SMILES | CCCC(/N=C(\N)NC(=O)OCC)C(=O)O |
| InChI | InChI=1S/C9H17N3O4/c1-3-5-6(7(13)14)11-8(10)12-9(15)16-4-2/h6H,3-5H2,1-2H3,(H,13,14)(H3,10,11,12,15) |
| InChIKey | NHVRITSEOHLPEN-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 114.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|