C10H21N3O2 — CID 166915171
tert-butyl N-(N'-butan-2-ylcarbamimidoyl)carbamate (PubChem CID 166915171) has the molecular formula C10H21N3O2 and a molecular weight of 215.30 g/mol. Its IUPAC name is tert-butyl N-(N'-butan-2-ylcarbamimidoyl)carbamate.
| Compound Name | tert-butyl N-(N'-butan-2-ylcarbamimidoyl)carbamate |
|---|---|
| PubChem CID | 166915171 |
| Molecular Formula | C10H21N3O2 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.16 |
| IUPAC Name | tert-butyl N-(N'-butan-2-ylcarbamimidoyl)carbamate |
| SMILES | CCC(C)/N=C(\N)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H21N3O2/c1-6-7(2)12-8(11)13-9(14)15-10(3,4)5/h7H,6H2,1-5H3,(H3,11,12,13,14) |
| InChIKey | MNIRMQANVIPWKY-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|