C8H17N3 — CID 145461023
2-butan-2-yl-1-prop-1-en-2-ylguanidine (PubChem CID 145461023) has the molecular formula C8H17N3 and a molecular weight of 155.24 g/mol. Its IUPAC name is 2-butan-2-yl-1-prop-1-en-2-ylguanidine.
| Compound Name | 2-butan-2-yl-1-prop-1-en-2-ylguanidine |
|---|---|
| PubChem CID | 145461023 |
| Molecular Formula | C8H17N3 |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.14 |
| IUPAC Name | 2-butan-2-yl-1-prop-1-en-2-ylguanidine |
| SMILES | C=C(C)N/C(N)=N/C(C)CC |
| InChI | InChI=1S/C8H17N3/c1-5-7(4)11-8(9)10-6(2)3/h7H,2,5H2,1,3-4H3,(H3,9,10,11) |
| InChIKey | KKRUNSJHEYWUEW-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|