C16H29N3O7 — CID 88888848
4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-2-hydroxypentanoic acid (PubChem CID 88888848) has the molecular formula C16H29N3O7 and a molecular weight of 375.42 g/mol. Its IUPAC name is 4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-2-hydroxypentanoic acid.
| Compound Name | 4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-2-hydroxypentanoic acid |
|---|---|
| PubChem CID | 88888848 |
| Molecular Formula | C16H29N3O7 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | 4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-2-hydroxypentanoic acid |
| SMILES | CC(CC(O)C(=O)O)N=C(NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H29N3O7/c1-9(8-10(20)11(21)22)17-12(18-13(23)25-15(2,3)4)19-14(24)26-16(5,6)7/h9-10,20H,8H2,1-7H3,(H,21,22)(H2,17,18,19,23,24) |
| InChIKey | AQHBYOYKQSUXME-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 146.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|